For research use only. Not for therapeutic Use.
5-Bromo-4-chloro-3-indolyl phosphate disodium salt (CAT: M003802) is a chromogenic substrate frequently used in enzymatic assays to detect the activity of alkaline phosphatase. In these assays, alkaline phosphatase cleaves the phosphate group from this substrate, resulting in the formation of a blue or purple precipitate. This reaction is widely used in various laboratory applications, such as detecting the presence of gene expression in molecular biology experiments or visualizing the activity of enzymes in immunohistochemistry.
Catalog Number | M003802 |
CAS Number | 102185-33-1 |
Molecular Formula | C8H4BrClNNa2O4P |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | disodium;(5-bromo-4-chloro-1H-indol-3-yl) phosphate |
InChI | InChI=1S/C8H6BrClNO4P.2Na/c9-4-1-2-5-7(8(4)10)6(3-11-5)15-16(12,13)14;;/h1-3,11H,(H2,12,13,14);;/q;2*+1/p-2 |
InChIKey | OAZUOCJOEUNDEK-UHFFFAOYSA-L |
SMILES | C1=CC(=C(C2=C1NC=C2OP(=O)([O-])[O-])Cl)Br.[Na+].[Na+] |