For research use only. Not for therapeutic Use.
5-Bromo-4-methyl-2-(methylsulfonyl)pyridine(Cat No.:L026022)is a heterocyclic compound used in organic synthesis and pharmaceutical research. The pyridine ring is substituted with a bromine atom at the 5-position, a methyl group at the 4-position, and a methylsulfonyl group at the 2-position. This combination of functional groups provides unique reactivity, making it a valuable intermediate in the synthesis of complex molecules, particularly for creating biologically active compounds. Its versatility in chemical reactions makes it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced materials.
CAS Number | 1279106-02-3 |
Molecular Formula | C7H8BrNO2S |
Purity | ≥95% |
IUPAC Name | 5-bromo-4-methyl-2-methylsulfonylpyridine |
InChI | InChI=1S/C7H8BrNO2S/c1-5-3-7(12(2,10)11)9-4-6(5)8/h3-4H,1-2H3 |
InChIKey | QRUHXFFHUQCWGD-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=C1Br)S(=O)(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |