For research use only. Not for therapeutic Use.
5-Bromo-6-chloropicolinic acid(Cat No.:L040086)is a high-purity halogenated picolinic acid derivative, widely used in pharmaceutical research and chemical synthesis. This compound features bromine and chlorine atoms substituted at the 5 and 6 positions, respectively, on the picolinic acid core, enhancing its reactivity and making it an essential building block for developing advanced molecules. Its unique structure allows for versatile applications, including drug design, agrochemical development, and material science. With consistent quality and high stability, 5-Bromo-6-chloropicolinic acid is ideal for innovative research.
CAS Number | 959958-25-9 |
Molecular Formula | C6H3BrClNO2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-6-chloropyridine-2-carboxylic acid |
InChI | InChI=1S/C6H3BrClNO2/c7-3-1-2-4(6(10)11)9-5(3)8/h1-2H,(H,10,11) |
InChIKey | SEBJRHGSFJEWFZ-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1Br)Cl)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |