For research use only. Not for therapeutic Use.
5-Bromo-6-fluoronicotinic acid(Cat No.:L042909)is a halogenated pyridine derivative featuring a bromine atom at the 5-position and a fluorine atom at the 6-position, with a carboxylic acid group attached to the nicotinic acid core. This compound is important in pharmaceutical research and organic synthesis as a building block for the development of bioactive molecules, including potential drug candidates. The presence of bromine and fluorine allows for versatile chemical modifications, such as cross-coupling reactions. Its high purity and reactivity make it essential for advanced research in medicinal chemistry and chemical synthesis.
CAS Number | 29241-63-2 |
Molecular Formula | C6H3BrFNO2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-6-fluoropyridine-3-carboxylic acid |
InChI | InChI=1S/C6H3BrFNO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2H,(H,10,11) |
InChIKey | VZBMIACXKWJDNS-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1Br)F)C(=O)O |