For research use only. Not for therapeutic Use.
5-Bromo-6-fluoroquinoline-2-carboxylic acid(Cat No.:L018953)is a heterocyclic compound featuring a bromine atom at the 5-position, a fluorine atom at the 6-position, and a carboxylic acid group at the 2-position of the quinoline ring. This compound is widely used as an intermediate in the synthesis of pharmaceuticals, particularly in the development of antimicrobial and anticancer agents. Its halogenated quinoline structure allows for versatile chemical modifications, making it valuable in medicinal chemistry for creating bioactive molecules. It plays a crucial role in drug discovery and the synthesis of complex organic compounds.
CAS Number | 1420790-57-3 |
Molecular Formula | C10H5BrFNO2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-6-fluoroquinoline-2-carboxylic acid |
InChI | InChI=1S/C10H5BrFNO2/c11-9-5-1-3-8(10(14)15)13-7(5)4-2-6(9)12/h1-4H,(H,14,15) |
InChIKey | ALSYIUBWVDLGQT-UHFFFAOYSA-N |
SMILES | C1=CC(=NC2=C1C(=C(C=C2)F)Br)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |