For research use only. Not for therapeutic Use.
5-Bromo-6-methylpicolinaldehyde is a specialized chemical compound used primarily in pharmaceutical and biochemical research. Its structure features a bromine atom and a methyl group attached to a picolinic aldehyde core, making it an important intermediate in the synthesis of various bioactive molecules. This compound plays a role in the development of targeted therapeutics, particularly in areas related to enzyme inhibition and receptor binding studies. It is highly valued for its purity and consistency in experimental applications.
CAS Number | 137778-18-8 |
Molecular Formula | C7H6BrNO |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 5-bromo-6-methylpyridine-2-carbaldehyde |
InChI | InChI=1S/C7H6BrNO/c1-5-7(8)3-2-6(4-10)9-5/h2-4H,1H3 |
InChIKey | BXPXGQBIEVDVOW-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=N1)C=O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |