For research use only. Not for therapeutic Use.
5-Bromo-8-fluoroisoquinolin-1(2H)-one(CAT: L016317) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a brominated and fluorinated isoquinolinone scaffold, this compound serves as a versatile intermediate for synthesizing bioactive molecules and complex organic compounds. Its unique structure is particularly valuable in medicinal chemistry for developing novel therapeutic agents and studying structure-activity relationships. With excellent stability and reactivity, 5-Bromo-8-fluoroisoquinolin-1(2H)-one ensures precision and reliability, making it a critical tool for advanced synthetic applications and innovative research.
CAS Number | 1536364-85-8 |
Molecular Formula | C9H5BrFNO |
Purity | ≥95% |
IUPAC Name | 5-bromo-8-fluoro-2H-isoquinolin-1-one |
InChI | InChI=1S/C9H5BrFNO/c10-6-1-2-7(11)8-5(6)3-4-12-9(8)13/h1-4H,(H,12,13) |
InChIKey | OPESYULZMXGCPX-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C=CNC(=O)C2=C1F)Br |