For research use only. Not for therapeutic Use.
5-Bromo-8-methoxy-2-methylquinoline is an aromatic heterocyclic compound featuring a quinoline structure with a bromine atom at the 5-position, a methoxy group at the 8-position, and a methyl group at the 2-position. This unique arrangement of substituents enhances its electronic properties and reactivity, making it useful in organic synthesis and medicinal chemistry. The compound may exhibit biological activity, serving as a potential scaffold for developing pharmaceuticals or agrochemicals. Its diverse functional groups allow for further modifications in research applications.
CAS Number | 103862-55-1 |
Molecular Formula | C11H10BrNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-bromo-8-methoxy-2-methylquinoline |
InChI | InChI=1S/C11H10BrNO/c1-7-3-4-8-9(12)5-6-10(14-2)11(8)13-7/h3-6H,1-2H3 |
InChIKey | MCBRCJBMVOOJFX-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=CC(=C2C=C1)Br)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |