For research use only. Not for therapeutic Use.
5-Bromo-N-methylpyridin-3-amine(CAT: L033698) is a valuable compound utilized in chemical research and pharmaceutical synthesis. Featuring a bromine atom at the 5-position of the pyridine ring and a methyl group on the nitrogen atom, this compound serves as a key intermediate in the development of various biologically active molecules. Its structure provides unique reactivity patterns, making it suitable for cross-coupling reactions and the formation of complex heterocyclic frameworks. 5-Bromo-N-methylpyridin-3-amine is ideal for medicinal chemistry, offering potential for the synthesis of analogs and derivatives that can be used in drug discovery and development projects.
CAS Number | 873383-06-3 |
Molecular Formula | C6H7BrN2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-N-methylpyridin-3-amine |
InChI | InChI=1S/C6H7BrN2/c1-8-6-2-5(7)3-9-4-6/h2-4,8H,1H3 |
InChIKey | AAQZNDQSCOUIEE-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |