For research use only. Not for therapeutic Use.
5-bromo-N,N-dimethylpicolinamide (Cat.No:L003483) is a crucial chemical compound in pharmaceutical research. Its distinct structure and bromine substituent make it a valuable scaffold for the synthesis of biologically active molecules. This compound’s versatility and reactivity have positioned it as a key intermediate in the development of potential therapeutic agents.
Catalog Number | L003483 |
CAS Number | 845305-86-4 |
Molecular Formula | C8H9BrN2O |
Purity | ≥95% |
IUPAC Name | 5-bromo-N,N-dimethylpyridine-2-carboxamide |
InChI | InChI=1S/C8H9BrN2O/c1-11(2)8(12)7-4-3-6(9)5-10-7/h3-5H,1-2H3 |
InChIKey | KQRHFAPOFNDZHY-UHFFFAOYSA-N |
SMILES | CN(C)C(=O)C1=NC=C(C=C1)Br |