For research use only. Not for therapeutic Use.
5-Bromobenzo[b]thiophene (Cat.No:R034688) is a chemical compound with a benzothiophene ring substituted with a bromine atom. It is used as a building block in the synthesis of various organic compounds, including pharmaceuticals and agrochemicals. This compound’s unique structure makes it valuable in creating molecules with diverse applications.
Catalog Number | R034688 |
CAS Number | 4923-87-9 |
Synonyms | 5-Bromobenzo[b]thiophene; 5-Bromo-1-benzothiophene; 5-Bromobenzothiophene |
Molecular Formula | C8H5BrS |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-bromo-1-benzothiophene |
InChI | InChI=1S/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
InChIKey | RDSIMGKJEYNNLF-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CS2)C=C1Br |