For research use only. Not for therapeutic Use.
5-(Bromomethyl)-1-methyl-1H-imidazole Hydrobromide(CAT: L016666) is a high-purity compound widely used in pharmaceutical and chemical research. This imidazole derivative, featuring a bromomethyl group, serves as a versatile intermediate in the synthesis of heterocyclic compounds and bioactive molecules. Its hydrobromide salt form enhances stability and solubility, making it ideal for complex organic synthesis and medicinal chemistry applications. 5-(Bromomethyl)-1-methyl-1H-imidazole Hydrobromide is particularly valuable in the development of therapeutic agents and the modification of biomolecules, offering reliability and precision for advanced research projects in drug discovery and organic chemistry.
CAS Number | 2007915-81-1 |
Molecular Formula | C5H8Br2N2 |
Purity | ≥95% |
IUPAC Name | 5-(bromomethyl)-1-methylimidazole;hydrobromide |
InChI | InChI=1S/C5H7BrN2.BrH/c1-8-4-7-3-5(8)2-6;/h3-4H,2H2,1H3;1H |
InChIKey | IUHNUZXGKLOGHZ-UHFFFAOYSA-N |
SMILES | CN1C=NC=C1CBr.Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |