For research use only. Not for therapeutic Use.
5-Bromonaphthalen-1-amine(Cat No.:L024372)is a high-purity aromatic compound widely used in pharmaceutical research and organic synthesis. This brominated naphthalene derivative, featuring an amine group, serves as a valuable intermediate in the development of bioactive molecules and complex chemical structures. Its unique combination of bromine and amine functionalities allows for selective modifications, making it essential in medicinal chemistry for synthesizing novel therapeutic agents. 5-Bromonaphthalen-1-amine is crucial for research focused on optimizing synthetic pathways and exploring new drug candidates, offering reliable performance in advanced chemical applications.
CAS Number | 4766-33-0 |
Molecular Formula | C10H8BrN |
Purity | ≥95% |
IUPAC Name | 5-bromonaphthalen-1-amine |
InChI | InChI=1S/C10H8BrN/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1-6H,12H2 |
InChIKey | VNPCNUAYDOLBDR-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC=C2Br)C(=C1)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |