For research use only. Not for therapeutic Use.
5-Bromopyrazolo[1,5-a]pyridine(CAT: L037752) is a heterocyclic compound that features a bromine atom at the 5-position of a fused pyrazolo-pyridine ring system. This structure combines a pyrazole ring fused to a pyridine, creating a rigid and electron-rich framework. The bromine atom enhances the compound’s reactivity, particularly in cross-coupling reactions such as Suzuki-Miyaura and Buchwald-Hartwig reactions, making it a valuable intermediate in organic synthesis. It is commonly used in medicinal chemistry and materials science for the development of pharmaceuticals, agrochemicals, and functional materials. The pyrazolo[1,5-a]pyridine core offers potential biological activity, contributing to its utility in drug discovery efforts.
CAS Number | 1060812-84-1 |
Molecular Formula | C7H5BrN2 |
Purity | ≥95% |
IUPAC Name | 5-bromopyrazolo[1,5-a]pyridine |
InChI | InChI=1S/C7H5BrN2/c8-6-2-4-10-7(5-6)1-3-9-10/h1-5H |
InChIKey | WQOAKXFBWOXJNG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |