For research use only. Not for therapeutic Use.
(5-Bromopyrimidin-2-yl)methanol(Cat No.:R024570), features a pyrimidine ring structure with a bromine atom and a hydroxymethyl group (-CH2OH) attached. This compound’s structure suggests its potential applications in organic synthesis, particularly as a building block for creating diverse molecules. The presence of the bromine atom and the hydroxymethyl group on the pyrimidine ring can influence its reactivity, making it valuable for preparing specialized compounds used in pharmaceuticals, agrochemicals, and other fine chemicals. Its unique functional groups offer opportunities for various chemical transformations.
CAS Number | 22433-12-1 |
Synonyms | 5-Bromo-2-hydroxymethylpyrimidine |
Molecular Formula | C5H5BrN2O |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | (5-bromopyrimidin-2-yl)methanol |
InChI | InChI=1S/C5H5BrN2O/c6-4-1-7-5(3-9)8-2-4/h1-2,9H,3H2 |
InChIKey | ZRHVXSBXNUJBGF-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=N1)CO)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |