5-Bromopyrimidine-4-carboxylic acid（Cat No.:L023440）is a halogenated pyrimidine derivative featuring a bromine atom at the 5-position and a carboxylic acid group at the 4-position. This compound is important in pharmaceutical research and organic synthesis as a building block for the development of bioactive molecules, including potential drug candidates and agrochemicals. The bromine atom allows for versatile chemical modifications, such as cross-coupling reactions, while the carboxylic acid group provides a functional handle for further derivatization. High purity ensures its effectiveness in advanced research and medicinal chemistry applications.
| Catalog Number | L023440 |
| CAS Number | 64224-60-8 |
| Molecular Formula | C5H3BrN2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-bromopyrimidine-4-carboxylic acid |
| InChI | InChI=1S/C5H3BrN2O2/c6-3-1-7-2-8-4(3)5(9)10/h1-2H,(H,9,10) |
| InChIKey | HZZBITVSVYFOND-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC=N1)C(=O)O)Br |
