5-Bromopyrimidine-4-carboxylic acid(Cat No.:L023440)is a halogenated pyrimidine derivative featuring a bromine atom at the 5-position and a carboxylic acid group at the 4-position. This compound is important in pharmaceutical research and organic synthesis as a building block for the development of bioactive molecules, including potential drug candidates and agrochemicals. The bromine atom allows for versatile chemical modifications, such as cross-coupling reactions, while the carboxylic acid group provides a functional handle for further derivatization. High purity ensures its effectiveness in advanced research and medicinal chemistry applications.
Catalog Number | L023440 |
CAS Number | 64224-60-8 |
Molecular Formula | C5H3BrN2O2 |
Purity | ≥95% |
IUPAC Name | 5-bromopyrimidine-4-carboxylic acid |
InChI | InChI=1S/C5H3BrN2O2/c6-3-1-7-2-8-4(3)5(9)10/h1-2H,(H,9,10) |
InChIKey | HZZBITVSVYFOND-UHFFFAOYSA-N |
SMILES | C1=C(C(=NC=N1)C(=O)O)Br |