For research use only. Not for therapeutic Use.
5-Caproic acid（Cat No.:M074432）, also known as pentanoic acid, is a carboxylic acid with a five-carbon chain. It is a colorless liquid with a pungent odor and is naturally found in various animal fats and oils, as well as some dairy products. 5-Caproic acid is used in the synthesis of esters for fragrances and flavorings, as well as in the production of various chemicals, including plasticizers and pharmaceuticals. Additionally, it serves as a precursor in the manufacture of nylon-6, a type of synthetic polymer.
| Catalog Number | M074432 |
| CAS Number | 16424-55-8 |
| Molecular Formula | C10H18O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (E)-dec-5-enoic acid |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h5-6H,2-4,7-9H2,1H3,(H,11,12)/b6-5+ |
| InChIKey | UJUXUEKQHBXUEM-AATRIKPKSA-N |
| SMILES | CCCCC=CCCCC(=O)O |
