For research use only. Not for therapeutic Use.
5-Chloro-1-methyl-1H-pyrazol-3-amine is a pyrazole derivative featuring a chlorine atom at the 5-position and a methyl group at the 1-position. This compound is notable in medicinal chemistry for its potential biological activities, including anti-inflammatory and anticancer properties. The presence of the chlorine enhances its reactivity, allowing for various chemical modifications. Its unique structure makes it a valuable intermediate in the synthesis of novel therapeutic agents and in exploring applications in organic synthesis and drug discovery.
CAS Number | 1191453-81-2 |
Molecular Formula | C4H6ClN3 |
Purity | ≥95% |
IUPAC Name | 5-chloro-1-methylpyrazol-3-amine |
InChI | InChI=1S/C4H6ClN3/c1-8-3(5)2-4(6)7-8/h2H,1H3,(H2,6,7) |
InChIKey | SEVSLCCFKWIBBN-UHFFFAOYSA-N |
SMILES | CN1C(=CC(=N1)N)Cl |