For research use only. Not for therapeutic Use.
5-Chloro-1,3-benzothiazole-4-sulfonamide(Cat No.:L007732), is a chemical compound with a benzothiazole core substituted with a chloro group at position 5 and a sulfonamide group at position 4. Benzothiazole derivatives have various applications in medicinal chemistry and materials science due to their unique structural features. Sulfonamide-containing compounds often exhibit biological activity, making them important in drug discovery and development. Researchers utilize this compound as a valuable intermediate in the synthesis of diverse molecules, including pharmaceuticals and agrochemicals, leveraging its structural features to create novel compounds with potential therapeutic or industrial applications.
CAS Number | 1099610-79-3 |
Molecular Formula | C7H5ClN2O2S2 |
Purity | ≥95% |
IUPAC Name | 5-chloro-1,3-benzothiazole-4-sulfonamide |
InChI | InChI=1S/C7H5ClN2O2S2/c8-4-1-2-5-6(10-3-13-5)7(4)14(9,11)12/h1-3H,(H2,9,11,12) |
InChIKey | FDUYZNRSOUZBEZ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C2=C1SC=N2)S(=O)(=O)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |