For research use only. Not for therapeutic Use.
5-Chloro-2-fluoro-4-(trifluoromethyl)benzoic acid (Cat.No:L003733) is a vital chemical compound with versatile applications in pharmaceutical research. Its unique structure, featuring halogen and trifluoromethyl groups, endows it with valuable reactivity. This compound serves as a key intermediate in the synthesis of specialized materials and pharmaceuticals.
CAS Number | 1807210-92-9 |
Molecular Formula | C8H3ClF4O2 |
Purity | ≥95% |
IUPAC Name | 5-chloro-2-fluoro-4-(trifluoromethyl)benzoic acid |
InChI | InChI=1S/C8H3ClF4O2/c9-5-1-3(7(14)15)6(10)2-4(5)8(11,12)13/h1-2H,(H,14,15) |
InChIKey | KQKOUBKHCIQIHI-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Cl)C(F)(F)F)F)C(=O)O |