For research use only. Not for therapeutic Use.
5-Chloro-2-fluorophenylhydrazine Hydrochloride(CAT: L024203) is a high-purity aromatic hydrazine derivative featuring chlorine and fluorine substituents on a phenyl ring, stabilized as a hydrochloride salt. This compound is widely utilized in pharmaceutical and chemical research as a key intermediate for synthesizing bioactive molecules, including heterocyclic compounds and pharmaceutical candidates. Its hydrazine group makes it highly reactive in the formation of hydrazones and diazene derivatives, while the hydrochloride form enhances solubility and handling. With consistent quality and excellent stability, 5-Chloro-2-fluorophenylhydrazine Hydrochloride is a valuable reagent for innovative research in medicinal chemistry and synthetic organic chemistry.
CAS Number | 529512-80-9 |
Molecular Formula | C6H7Cl2FN2 |
Purity | ≥95% |
IUPAC Name | (5-chloro-2-fluorophenyl)hydrazine;hydrochloride |
InChI | InChI=1S/C6H6ClFN2.ClH/c7-4-1-2-5(8)6(3-4)10-9;/h1-3,10H,9H2;1H |
InChIKey | XYWXFBGIZMKSDU-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)NN)F.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |