5-Chloro-2-methoxy-3-nitrobenzoic acid

For research use only. Not for therapeutic Use.

  • CAT Number: L007470
  • CAS Number: 89894-14-4
  • Molecular Formula: C8H6ClNO5
  • Molecular Weight: 231.59
  • Purity: ≥95%
Inquiry Now

5-Chloro-2-methoxy-3-nitrobenzoic acid(Cat No.:L007470), is a chemical compound featuring a benzene ring with chloro (-Cl), methoxy (-OCH3), and nitro (-NO2) functional groups attached at specific positions. This specific arrangement of atoms grants the compound unique chemical properties, making it valuable in various research and industrial applications. Scientists often use it as a building block in the synthesis of more complex organic compounds due to its reactivity and ability to participate in various chemical reactions.


CAS Number 89894-14-4
Molecular Formula C8H6ClNO5
Purity ≥95%
IUPAC Name 5-chloro-2-methoxy-3-nitrobenzoic acid
InChI InChI=1S/C8H6ClNO5/c1-15-7-5(8(11)12)2-4(9)3-6(7)10(13)14/h2-3H,1H3,(H,11,12)
InChIKey BNPVOSZKWOIXHK-UHFFFAOYSA-N
SMILES COC1=C(C=C(C=C1[N+](=O)[O-])Cl)C(=O)O

Request a Quote