For research use only. Not for therapeutic Use.
5-Chloro-2-methylpyrazolo[1,5-a]pyrimidine(CAT: L040714) is a heterocyclic compound containing a fused pyrazolo-pyrimidine core with a chlorine atom at position 5 and a methyl group at position 2. This compound is commonly used in medicinal chemistry for the synthesis of biologically active molecules. Its structure makes it a valuable scaffold in drug discovery, especially for developing kinase inhibitors, antiviral agents, and anti-inflammatory drugs. The presence of both chlorine and methyl groups can enhance the compound’s binding affinity to biological targets, making it a versatile intermediate for various pharmaceutical applications.
CAS Number | 189116-36-7 |
Molecular Formula | C7H6ClN3 |
Purity | ≥95% |
IUPAC Name | 5-chloro-2-methylpyrazolo[1,5-a]pyrimidine |
InChI | InChI=1S/C7H6ClN3/c1-5-4-7-9-6(8)2-3-11(7)10-5/h2-4H,1H3 |
InChIKey | CFBYPOBAHXWIFK-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |