For research use only. Not for therapeutic Use.
5-Chloro-2-naphthoic acid(Cat No.:L029630)is a chlorinated aromatic compound widely used in organic synthesis and pharmaceutical research. With a chlorine atom positioned on the naphthalene ring, this compound serves as a key intermediate in the preparation of dyes, pigments, and various bioactive molecules. It is particularly valuable in the synthesis of anti-inflammatory agents, antibiotics, and other therapeutic compounds. The unique structural features of 5-chloro-2-naphthoic acid make it essential for developing complex molecular frameworks, contributing to advancements in drug discovery and material science research.
CAS Number | 56961-89-8 |
Molecular Formula | C11H7ClO2 |
Purity | ≥95% |
IUPAC Name | 5-chloronaphthalene-2-carboxylic acid |
InChI | InChI=1S/C11H7ClO2/c12-10-3-1-2-7-6-8(11(13)14)4-5-9(7)10/h1-6H,(H,13,14) |
InChIKey | WVRYXJXPKJMSON-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C(=C1)Cl |