Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-Chloro-2-((R)-5-Methyl-[1,4]diazepan-1-yl)benzooxazole hydrochloride
For research use only. Not for therapeutic Use.
5-Chloro-2-((R)-5-Methyl-[1,4]diazepan-1-yl)benzooxazole hydrochloride(Cat No.:L002447)is a complex chemical compound utilized in pharmaceutical research, particularly in the synthesis of potential therapeutic agents. This compound features a benzooxazole core with a diazepan ring and a chiral methyl group, providing unique structural properties important for drug design. The hydrochloride salt form enhances its solubility and stability, making it suitable for various experimental applications. It plays a crucial role in medicinal chemistry, supporting the development of new drugs and the exploration of novel biological pathways.
Catalog Number | L002447 |
CAS Number | 1266664-66-7 |
Molecular Formula | C13H17Cl2N3O |
Purity | ≥95% |
IUPAC Name | 5-chloro-2-[(5R)-5-methyl-1,4-diazepan-1-yl]-1,3-benzoxazole;hydrochloride |
InChI | InChI=1S/C13H16ClN3O.ClH/c1-9-4-6-17(7-5-15-9)13-16-11-8-10(14)2-3-12(11)18-13;/h2-3,8-9,15H,4-7H2,1H3;1H/t9-;/m1./s1 |
InChIKey | ZCQKTYRISREUFV-SBSPUUFOSA-N |
SMILES | CC1CCN(CCN1)C2=NC3=C(O2)C=CC(=C3)Cl.Cl |