For research use only. Not for therapeutic Use.
5-Chloro-2-thiophenecarbonitrile(Cat No.:L006892), is an important organic compound utilized in the synthesis of pharmaceuticals and agrochemicals. Its molecular structure includes a thiophene ring with a cyano group at the 2nd position and a chlorine atom at the 5th position. This compound serves as a valuable intermediate in the creation of various organic derivatives, allowing chemists to design and develop new molecules with desired properties. Its functional groups enable diverse chemical transformations, making it useful in the generation of complex heterocyclic compounds.
CAS Number | 50478-16-5 |
Molecular Formula | C5H2ClNS |
Purity | ≥95% |
Storage | 2–8 °C |
IUPAC Name | 5-chlorothiophene-2-carbonitrile |
InChI | InChI=1S/C5H2ClNS/c6-5-2-1-4(3-7)8-5/h1-2H |
InChIKey | MZALEEOEVCTDJA-UHFFFAOYSA-N |
SMILES | C1=C(SC(=C1)Cl)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |