For research use only. Not for therapeutic Use.
2-(4-Fluoro-1H-pyrazol-1-yl)ethanamine(CAT: L048219) is a high-purity chemical compound widely used in pharmaceutical and biochemical research. Featuring a fluorinated pyrazole ring and an ethanamine side chain, this compound serves as a versatile building block in the synthesis of bioactive molecules, including drug candidates and enzyme inhibitors. Its unique structure and functional groups make it suitable for studying receptor-ligand interactions, metabolic pathways, and medicinal chemistry applications. Known for its stability and ease of incorporation into complex molecular frameworks, 2-(4-Fluoro-1H-pyrazol-1-yl)ethanamine is an invaluable resource for researchers advancing drug discovery and development.
CAS Number | 261763-24-0 |
Molecular Formula | C8H5BrClF3 |
Purity | ≥95% |
IUPAC Name | 2-(bromomethyl)-4-chloro-1-(trifluoromethyl)benzene |
InChI | InChI=1S/C8H5BrClF3/c9-4-5-3-6(10)1-2-7(5)8(11,12)13/h1-3H,4H2 |
InChIKey | OUNFGTVHRCWPKY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)CBr)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |