For research use only. Not for therapeutic Use.
5-Chloro-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine(Cat No.:L028973)is a heterocyclic compound featuring a chlorinated pyrido-oxazine ring system. This compound is widely used in pharmaceutical research and organic synthesis as a building block for developing biologically active molecules, including potential drug candidates. Its structure, combining a pyridine ring with an oxazine moiety, offers unique reactivity, making it suitable for various chemical transformations. Researchers in medicinal chemistry value this compound for its role in creating innovative therapies and exploring new pathways in drug discovery and development.
Catalog Number | L028973 |
CAS Number | 1260665-77-7 |
Molecular Formula | C7H7ClN2O |
Purity | ≥95% |
IUPAC Name | 5-chloro-2,3-dihydro-1H-pyrido[3,4-b][1,4]oxazine |
InChI | InChI=1S/C7H7ClN2O/c8-7-6-5(1-2-10-7)9-3-4-11-6/h1-2,9H,3-4H2 |
InChIKey | RDQGIMGORJDQCL-UHFFFAOYSA-N |
SMILES | C1COC2=C(N1)C=CN=C2Cl |