For research use only. Not for therapeutic Use.
5-Chloro-2,4-difluorophenylacetonitrile is an aromatic compound featuring a chloro group at the 5-position and two fluorine atoms at the 2 and 4-positions of a phenyl ring, along with an acetonitrile functional group. This compound is significant in medicinal chemistry due to its potential biological activities, including antifungal and anticancer properties. The presence of halogen substituents enhances its reactivity and solubility, making it a valuable intermediate for further chemical transformations in drug development and organic synthesis.
Catalog Number | L022222 |
CAS Number | 1429422-26-3 |
Molecular Formula | C8H4ClF2N |
Purity | ≥95% |
IUPAC Name | 2-(5-chloro-2,4-difluorophenyl)acetonitrile |
InChI | InChI=1S/C8H4ClF2N/c9-6-3-5(1-2-12)7(10)4-8(6)11/h3-4H,1H2 |
InChIKey | SZLMXGXTRBGVJV-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Cl)F)F)CC#N |