For research use only. Not for therapeutic Use.
5-Chloro-2,4-difluoropyridine(CAT: L048788) is a halogenated pyridine compound, valuable in pharmaceutical and agrochemical research as a key intermediate in the synthesis of complex molecules. The presence of both chlorine and fluorine atoms on the pyridine ring enhances its reactivity and allows for selective derivatization, making it ideal for creating diverse chemical scaffolds. This compound is frequently used to develop novel bioactive agents, particularly in applications targeting infectious diseases, inflammation, or neurological conditions. 5-Chloro-2,4-difluoropyridine offers stability and versatility, supporting efficient synthesis in advanced medicinal chemistry and research settings.
CAS Number | 1807257-52-8 |
Molecular Formula | C5H2ClF2N |
Purity | ≥95% |
IUPAC Name | 5-chloro-2,4-difluoropyridine |
InChI | InChI=1S/C5H2ClF2N/c6-3-2-9-5(8)1-4(3)7/h1-2H |
InChIKey | BKEHDGPFLXDGDC-UHFFFAOYSA-N |