For research use only. Not for therapeutic Use.
5-Chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole(Cat No.:L029835)is a heterocyclic compound featuring a 1,2,4-oxadiazole ring substituted with chlorine and a fluorophenyl group. This structure is notable for its electronic properties, making it a key intermediate in the synthesis of advanced materials and pharmaceuticals. The oxadiazole ring is known for its contribution to thermal and chemical stability, while the fluorophenyl group enhances the compound’s binding affinity in drug-target interactions. 5-Chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole is especially valuable in creating compounds with potential applications in antiviral and anticancer therapies.
CAS Number | 525574-81-6 |
Molecular Formula | C8H4ClFN2O |
Purity | ≥95% |
IUPAC Name | 5-chloro-3-(2-fluorophenyl)-1,2,4-oxadiazole |
InChI | InChI=1S/C8H4ClFN2O/c9-8-11-7(12-13-8)5-3-1-2-4-6(5)10/h1-4H |
InChIKey | SGIXUDYJVLXHJP-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)Cl)F |