For research use only. Not for therapeutic Use.
5-Chloro-3-fluoro-2-iodoaniline (Cat.No:L003365) is a significant chemical compound with applications in pharmaceutical and agrochemical research. Its distinctive structure makes it a valuable building block for the synthesis of novel compounds, highlighting its importance in modern chemical discovery.
Catalog Number | L003365 |
CAS Number | 2092184-10-4 |
Molecular Formula | C6H4ClFIN |
Purity | ≥95% |
IUPAC Name | 5-chloro-3-fluoro-2-iodoaniline |
InChI | InChI=1S/C6H4ClFIN/c7-3-1-4(8)6(9)5(10)2-3/h1-2H,10H2 |
InChIKey | NKOBMARTAZKRPP-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1N)I)F)Cl |