For research use only. Not for therapeutic Use.
5-Chloro-3-fluoropyridine-2-carboxamide(Cat No.:L030521)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features a pyridine ring substituted with a chlorine atom at the 5-position, a fluorine atom at the 3-position, and a carboxamide group at the 2-position. This structure provides unique reactivity, making it a valuable intermediate in the synthesis of biologically active molecules, particularly in drug development. The combination of halogens and the carboxamide group allows for versatile chemical modifications, essential for researchers focused on medicinal chemistry, drug discovery, and the creation of advanced therapeutic agents.
CAS Number | 207994-10-3 |
Molecular Formula | C6H4ClFN2O |
Purity | ≥95% |
IUPAC Name | 5-chloro-3-fluoropyridine-2-carboxamide |
InChI | InChI=1S/C6H4ClFN2O/c7-3-1-4(8)5(6(9)11)10-2-3/h1-2H,(H2,9,11) |
InChIKey | LPSRKMGUAAQVQQ-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1F)C(=O)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |