For research use only. Not for therapeutic Use.
5-Chloro-3-methyl-2(1H)-pyrazinone(Cat No.:M134679)is a heterocyclic compound characterized by a pyrazinone ring system substituted with chlorine and methyl groups. This structural arrangement enhances its chemical reactivity and potential biological activity, making it useful in the synthesis of pharmaceutical and agrochemical products. The chlorine atom increases the electron-withdrawing properties, improving the compound’s ability to participate in various organic reactions. The methyl group contributes to increased steric bulk and lipophilicity, which can affect the compound’s pharmacokinetic properties. 5-Chloro-3-methyl-2(1H)-pyrazinone is a valuable intermediate in developing new therapeutic agents and other specialized chemicals.
CAS Number | 105985-18-0 |
Molecular Formula | C5H5ClN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-chloro-3-methyl-1H-pyrazin-2-one |
InChI | InChI=1S/C5H5ClN2O/c1-3-5(9)7-2-4(6)8-3/h2H,1H3,(H,7,9) |
InChIKey | RPSYCJIAXZWJQS-UHFFFAOYSA-N |
SMILES | CC1=NC(=CNC1=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |