For research use only. Not for therapeutic Use.
3-(Prop-2-en-1-yl)piperidine(Cat No.:L007652), is a chemical compound featuring a piperidine ring substituted with a propenyl group at the 3-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable intermediate for the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals. Its versatile nature allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery and research purposes.
CAS Number | 1781859-25-3 |
Molecular Formula | C9H4ClFO3 |
Purity | ≥95% |
IUPAC Name | 5-chloro-6-fluoro-1-benzofuran-2-carboxylic acid |
InChI | InChI=1S/C9H4ClFO3/c10-5-1-4-2-8(9(12)13)14-7(4)3-6(5)11/h1-3H,(H,12,13) |
InChIKey | SQMUCQPNWWFEGN-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |