For research use only. Not for therapeutic Use.
5-Chloro-6-fluoro-1H-indazole(Cat No.:L007560), is a chemical compound featuring an indazole ring substituted with chlorine at the 5th position and fluorine at the 6th position. This compound is crucial in medicinal chemistry and drug discovery research. Its unique structure suggests potential pharmacological activities, making it valuable for further exploration in the development of pharmaceutical agents. Researchers study its reactivity and interactions with biological targets, aiming to design novel drugs.
CAS Number | 1305207-97-9 |
Molecular Formula | C7H4ClFN2 |
Purity | ≥95% |
IUPAC Name | 5-chloro-6-fluoro-1H-indazole |
InChI | InChI=1S/C7H4ClFN2/c8-5-1-4-3-10-11-7(4)2-6(5)9/h1-3H,(H,10,11) |
InChIKey | FHIQDGOGNZXFHR-UHFFFAOYSA-N |
SMILES | C1=C2C=NNC2=CC(=C1Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |