For research use only. Not for therapeutic Use.
5-Chloro-6-methoxypicolinaldehyde(CAT: L049057) is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. Featuring a picolinaldehyde core with a chlorine atom at the 5-position and a methoxy group at the 6-position, this compound serves as a versatile intermediate in the synthesis of complex organic molecules, including bioactive compounds and drug candidates. Its unique structure and reactivity make it particularly valuable for applications in medicinal chemistry, such as the development of enzyme inhibitors and receptor modulators. 5-Chloro-6-methoxypicolinaldehyde ensures consistent performance, supporting innovative research in drug discovery and advanced organic synthesis.
CAS Number | 1211527-87-5 |
Molecular Formula | C7H6ClNO2 |
Purity | ≥95% |
IUPAC Name | 5-chloro-6-methoxypyridine-2-carbaldehyde |
InChI | InChI=1S/C7H6ClNO2/c1-11-7-6(8)3-2-5(4-10)9-7/h2-4H,1H3 |
InChIKey | PDAALXFPGANGAU-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=N1)C=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |