For research use only. Not for therapeutic Use.
5-Chloroindole-2-carboxylic Acid (Cat.No:R045756) is a chemical compound with a chlorinated indole ring and a carboxylic acid group. It serves as a valuable building block in pharmaceutical and agrochemical synthesis, enabling the creation of diverse molecules with potential biological activities. This compound is widely used in research and development.
CAS Number | 10517-21-2 |
Synonyms | 5-Chloro-1H-indole-2-carboxylic Acid; 2-Carboxy-5-chloroindole; NSC 75651 |
Molecular Formula | C9H6ClNO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 5-chloro-1H-indole-2-carboxylic acid |
InChI | InChI=1S/C9H6ClNO2/c10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h1-4,11H,(H,12,13) |
InChIKey | FUQOTYRCMBZFOL-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1Cl)C=C(N2)C(=O)O |