For research use only. Not for therapeutic Use.
5-(Chloromethyl)uracil(Cat No.:L048463)is a chlorinated derivative of uracil, a key pyrimidine nucleobase found in RNA. This compound is commonly used in pharmaceutical research and organic synthesis as an intermediate for the development of nucleoside analogs and other biologically active molecules. The chloromethyl group at the 5-position provides unique reactivity, allowing for further chemical modifications, such as substitution reactions, to create complex structures. Researchers in medicinal chemistry utilize this compound in the design of antiviral, anticancer, and other therapeutic agents, exploring novel pathways in drug discovery.
CAS Number | 3590-48-5 |
Molecular Formula | C5H5ClN2O2 |
Purity | ≥95% |
IUPAC Name | 5-(chloromethyl)-1H-pyrimidine-2,4-dione |
InChI | InChI=1S/C5H5ClN2O2/c6-1-3-2-7-5(10)8-4(3)9/h2H,1H2,(H2,7,8,9,10) |
InChIKey | UCDUBKRXOPMNGH-UHFFFAOYSA-N |
SMILES | C1=C(C(=O)NC(=O)N1)CCl |