For research use only. Not for therapeutic Use.
(5-Chloropyrazin-2-yl)methanamine(Cat No.:L043101)is a heterocyclic compound featuring a chlorinated pyrazine ring with a methanamine group attached to the 2-position. This compound is widely used in pharmaceutical and chemical research as a versatile intermediate for synthesizing bioactive molecules, including potential therapeutic agents. Its structure allows for various chemical modifications, making it valuable in the development of complex organic compounds and drug candidates. (5-Chloropyrazin-2-yl)methanamine is essential for researchers focused on innovative medicinal chemistry and synthetic methodologies.
CAS Number | 1060814-53-0 |
Molecular Formula | C5H6ClN3 |
Purity | ≥95% |
IUPAC Name | (5-chloropyrazin-2-yl)methanamine |
InChI | InChI=1S/C5H6ClN3/c6-5-3-8-4(1-7)2-9-5/h2-3H,1,7H2 |
InChIKey | SYZWYECIPSWFJM-UHFFFAOYSA-N |
SMILES | C1=C(N=CC(=N1)Cl)CN |