For research use only. Not for therapeutic Use.
5-Chloropyrazine-2-carboxylic Acid(CAT: L048177) is a heterocyclic compound featuring a pyrazine ring substituted with a chlorine atom at the 5-position and a carboxylic acid group (-COOH) at the 2-position. The pyrazine ring, consisting of a six-membered structure with two nitrogen atoms at positions 1 and 4, imparts unique electronic properties, making it a useful scaffold in medicinal chemistry and drug design. The chlorine atom introduces further reactivity, especially in substitution reactions, while the carboxylic acid group allows for modifications, such as esterification or amidation. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its versatile functional groups.
CAS Number | 36070-80-1 |
Molecular Formula | C5H3ClN2O2 |
Purity | ≥95% |
IUPAC Name | 5-chloropyrazine-2-carboxylic acid |
InChI | InChI=1S/C5H3ClN2O2/c6-4-2-7-3(1-8-4)5(9)10/h1-2H,(H,9,10) |
InChIKey | FXJOTWLLDJYKAG-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |