For research use only. Not for therapeutic Use.
(5-Chloropyrimidin-2-yl)methanol(Cat No.:L037727)is an organic compound used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The chloropyrimidine ring structure provides a versatile platform for further chemical modifications, making it valuable in the development of drugs, especially those targeting enzymes or receptors in medicinal chemistry. The hydroxymethyl group at the 2-position offers additional reactivity, enabling its incorporation into more complex molecules. This compound is essential in research and industrial applications for developing novel therapeutic agents and crop protection products.
CAS Number | 944902-98-1 |
Molecular Formula | C5H5ClN2O |
Purity | ≥95% |
IUPAC Name | (5-chloropyrimidin-2-yl)methanol |
InChI | InChI=1S/C5H5ClN2O/c6-4-1-7-5(3-9)8-2-4/h1-2,9H,3H2 |
InChIKey | JVEHUYPEVMKBOE-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=N1)CO)Cl |