For research use only. Not for therapeutic Use.
5-Chloroquinoline(Cat No.:R003583), is a chemical compound with the molecular formula C9H6ClN. It features a quinoline ring structure with a chlorine atom attached. This compound’s structure signifies its potential applications in various chemical contexts, particularly in organic synthesis and medicinal chemistry. Quinoline derivatives often exhibit diverse biological activities, and the presence of the chlorine atom can influence its reactivity and properties, making it valuable in creating specialized molecules used in pharmaceutical research, agrochemicals, and other fine chemicals. It’s unique ring system and functional group offer opportunities for diverse reactions and transformations.
CAS Number | 635-27-8 |
Molecular Formula | C9H6ClN |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 5-chloroquinoline |
InChI | InChI=1S/C9H6ClN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
InChIKey | HJSRGOVAIOPERP-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC=N2)C(=C1)Cl |