For research use only. Not for therapeutic Use.
5-Chlorothiophene-3-carbaldehyde is a heterocyclic compound featuring a thiophene ring substituted with a chlorine atom at the 5-position and an aldehyde group at the 3-position. It is commonly used in organic synthesis and pharmaceutical research as a versatile building block for creating bioactive molecules, particularly in the development of drugs and agrochemicals. Its structure allows for various chemical modifications, making it useful in synthesizing complex heterocycles and other derivatives, contributing to advancements in medicinal chemistry and material science.
Catalog Number | L040387 |
CAS Number | 36155-85-8 |
Molecular Formula | C5H3ClOS |
Purity | ≥95% |
IUPAC Name | 5-chlorothiophene-3-carbaldehyde |
InChI | InChI=1S/C5H3ClOS/c6-5-1-4(2-7)3-8-5/h1-3H |
InChIKey | BGOGYRKWKJGOHZ-UHFFFAOYSA-N |