For research use only. Not for therapeutic Use.
5-Cyano-2,3-dihydro-1H-indole(Cat No.:M080805)is a versatile heterocyclic compound with a cyano group at the 5-position, commonly used in pharmaceutical and organic chemistry research. This indole derivative is valuable as a building block for synthesizing various biologically active molecules, including drug candidates and natural product analogs. Its unique structure, combining an indole core with a cyano functional group, facilitates the development of compounds with potential therapeutic applications, particularly in oncology and neuroscience. 5-Cyano-2,3-dihydro-1H-indole is crucial for advancing innovative research in medicinal chemistry.
CAS Number | 15861-23-1 |
Molecular Formula | C9H8N2 |
Purity | ≥95% |
IUPAC Name | 2,3-dihydro-1H-indole-5-carbonitrile |
InChI | InChI=1S/C9H8N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-2,5,11H,3-4H2 |
InChIKey | KBNWGVBBEPQFIZ-UHFFFAOYSA-N |
SMILES | C1CNC2=C1C=C(C=C2)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |