For research use only. Not for therapeutic Use.
5-Cyanoindole is an organic compound featuring an indole core with a cyano group (-CN) attached at the 5-position. It serves as an important building block in the synthesis of various pharmaceuticals and biologically active molecules. Its indole structure mimics that of tryptophan, allowing it to interact with biological targets like receptors and enzymes. The presence of the cyano group enhances its reactivity, making it useful in drug discovery, particularly in the development of kinase inhibitors, anticancer agents, and other therapeutic compounds. 5-Cyanoindole is highly valued for its versatility in medicinal chemistry and organic synthesis.
CAS Number | 15861-24-2 |
Synonyms | Indole-5-carnonitrile; 1H-Indole-5-carbonitrile |
Molecular Formula | C9H6N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1H-indole-5-carbonitrile |
InChI | InChI=1S/C9H6N2/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5,11H |
InChIKey | YHYLDEVWYOFIJK-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN2)C=C1C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |