For research use only. Not for therapeutic Use.
5′-Deoxy-5′-chloroadenosine is a modified nucleoside analogue with significant implications in biochemical research and medicinal chemistry. This compound features a chlorine substituent at the 5′ position of the adenosine structure, influencing its biological activity. It acts as an inhibitor of various enzymes and has potential applications in studying cellular processes and signaling pathways. The unique properties of 5′-Deoxy-5′-chloroadenosine make it a valuable tool in exploring nucleoside metabolism and developing therapeutic agents for treating viral infections and cancers.
CAS Number | 892-48-8 |
Synonyms | 5’-Chloro-5’-deoxyadenosine; |
Molecular Formula | C10H12ClN5O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2R,3R,4S,5S)-2-(6-aminopurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol |
InChI | InChI=1S/C10H12ClN5O3/c11-1-4-6(17)7(18)10(19-4)16-3-15-5-8(12)13-2-14-9(5)16/h2-4,6-7,10,17-18H,1H2,(H2,12,13,14)/t4-,6-,7-,10-/m1/s1 |
InChIKey | IYSNPOMTKFZDHZ-KQYNXXCUSA-N |
SMILES | C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)CCl)O)O |