For research use only. Not for therapeutic Use.
5-Deoxy-L-arabinose is a sugar derivative notable for its structural uniqueness and role in biochemistry. Lacking a hydroxyl group at the 5-position, it plays a critical role in the biosynthesis of various natural products, including antibiotics and glycosylated compounds. This compound is of interest in the study of nucleosides and nucleotides, contributing to advancements in medicinal chemistry and drug development. Its distinct properties make it a valuable building block in synthetic organic chemistry and research into carbohydrate-based therapies.
| CAS Number | 13039-56-0 |
| Synonyms | L-5-Deoxyarabinose; 5-Methyl-tetrahydro-furan-2,3,4-triol; |
| Molecular Formula | C5H10O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R,3S,4S)-2,3,4-trihydroxypentanal |
| InChI | InChI=1S/C5H10O4/c1-3(7)5(9)4(8)2-6/h2-5,7-9H,1H3/t3-,4-,5-/m0/s1 |
| InChIKey | WDRISBUVHBMJEF-YUPRTTJUSA-N |
| SMILES | CC(C(C(C=O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
