For research use only. Not for therapeutic Use.
5′-Deoxy thymidine（Cat No.:I011448）, also known as thymidine 5′-monophosphate, is a nucleoside derivative of thymine, one of the four nucleotides that make up DNA. It consists of a thymine base attached to a deoxyribose sugar with a phosphate group at the 5′ position. This compound plays a key role in the synthesis of DNA, as it is incorporated into DNA strands during replication. It is also a precursor in the production of other nucleotides and has been studied for its potential in antiviral and anticancer therapies due to its involvement in nucleic acid metabolism.
| CAS Number | 3458-14-8 |
| Synonyms | 5/’-deoxy-thymidine |
| Molecular Formula | C10H14N2O4 |
| Purity | ≥95% |
| Target | Antibiotic |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| InChI | InChI=1S/C10H14N2O4/c1-5-4-12(10(15)11-9(5)14)8-3-7(13)6(2)16-8/h4,6-8,13H,3H2,1-2H3,(H,11,14,15)/t6-,7+,8-/m1/s1 |
| InChIKey | UGUILUGCFSCUKR-GJMOJQLCSA-N |
| SMILES | C[C@@H]1[C@H](C[C@@H](O1)N2C=C(C(=O)NC2=O)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
