For research use only. Not for therapeutic Use.
5′-Deoxyadenosine(Cat No.:I000087)is a nucleoside analog used in biochemical research for studying enzymatic processes and cellular metabolism. It lacks a hydroxyl group at the 5′ position, making it resistant to phosphorylation and thus acting as an inhibitor of nucleic acid synthesis. This compound is valuable in investigating the mechanisms of adenosylcobalamin (coenzyme B12)-dependent enzymes and other metabolic pathways. Its unique structure allows researchers to explore nucleotide metabolism, enzyme function, and potential therapeutic applications, particularly in targeting specific biochemical pathways involved in disease.
CAS Number | 4754-39-6 |
Synonyms | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-methyloxolane-3,4-diol |
Molecular Formula | C10H13N5O3 |
Purity | ≥95% |
IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-methyloxolane-3,4-diol |
InChI | InChI=1S/C10H13N5O3/c1-4-6(16)7(17)10(18-4)15-3-14-5-8(11)12-2-13-9(5)15/h2-4,6-7,10,16-17H,1H3,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 |
InChIKey | XGYIMTFOTBMPFP-KQYNXXCUSA-N |
SMILES | CC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |